C10H9ClN4O2 — CID 64788698
N-(3-chloro-4-hydroxyphenyl)-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 64788698) has the molecular formula C10H9ClN4O2 and a molecular weight of 252.66 g/mol. Its IUPAC name is N-(3-chloro-4-hydroxyphenyl)-2-(1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-(3-chloro-4-hydroxyphenyl)-2-(1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 64788698 |
| Molecular Formula | C10H9ClN4O2 |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | N-(3-chloro-4-hydroxyphenyl)-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | O=C(Cn1cncn1)Nc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C10H9ClN4O2/c11-8-3-7(1-2-9(8)16)14-10(17)4-15-6-12-5-13-15/h1-3,5-6,16H,4H2,(H,14,17) |
| InChIKey | JFQJJGAQZBABIP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|