C14H15ClN4O2 — CID 75455006
N-(4-acetyl-3-chlorophenyl)-4-(1,2,4-triazol-1-yl)butanamide (PubChem CID 75455006) has the molecular formula C14H15ClN4O2 and a molecular weight of 306.75 g/mol. Its IUPAC name is N-(4-acetyl-3-chlorophenyl)-4-(1,2,4-triazol-1-yl)butanamide.
| Compound Name | N-(4-acetyl-3-chlorophenyl)-4-(1,2,4-triazol-1-yl)butanamide |
|---|---|
| PubChem CID | 75455006 |
| Molecular Formula | C14H15ClN4O2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | N-(4-acetyl-3-chlorophenyl)-4-(1,2,4-triazol-1-yl)butanamide |
| SMILES | CC(=O)c1ccc(NC(=O)CCCn2cncn2)cc1Cl |
| InChI | InChI=1S/C14H15ClN4O2/c1-10(20)12-5-4-11(7-13(12)15)18-14(21)3-2-6-19-9-16-8-17-19/h4-5,7-9H,2-3,6H2,1H3,(H,18,21) |
| InChIKey | CIZMYESCHRIJKA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |