C7H12N4O — CID 61037544
N-methyl-4-(1,2,4-triazol-1-yl)butanamide (PubChem CID 61037544) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is N-methyl-4-(1,2,4-triazol-1-yl)butanamide.
| Compound Name | N-methyl-4-(1,2,4-triazol-1-yl)butanamide |
|---|---|
| PubChem CID | 61037544 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | N-methyl-4-(1,2,4-triazol-1-yl)butanamide |
| SMILES | CNC(=O)CCCn1cncn1 |
| InChI | InChI=1S/C7H12N4O/c1-8-7(12)3-2-4-11-6-9-5-10-11/h5-6H,2-4H2,1H3,(H,8,12) |
| InChIKey | XEHGBBNKXZQLOX-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |