C12H21N5O2 — CID 131948202
(2S)-4-methyl-2-[4-(1,2,4-triazol-1-yl)butanoylamino]pentanamide (PubChem CID 131948202) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (2S)-4-methyl-2-[4-(1,2,4-triazol-1-yl)butanoylamino]pentanamide.
| Compound Name | (2S)-4-methyl-2-[4-(1,2,4-triazol-1-yl)butanoylamino]pentanamide |
|---|---|
| PubChem CID | 131948202 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | (2S)-4-methyl-2-[4-(1,2,4-triazol-1-yl)butanoylamino]pentanamide |
| SMILES | CC(C)C[C@H](NC(=O)CCCn1cncn1)C(N)=O |
| InChI | InChI=1S/C12H21N5O2/c1-9(2)6-10(12(13)19)16-11(18)4-3-5-17-8-14-7-15-17/h7-10H,3-6H2,1-2H3,(H2,13,19)(H,16,18)/t10-/m0/s1 |
| InChIKey | VHTMACSIJKTPBR-JTQLQIEISA-N |
| XLogP | 0.07 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |