C9H16N4O2 — CID 110899828
N-(3-hydroxypropyl)-4-(1,2,4-triazol-1-yl)butanamide (PubChem CID 110899828) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-4-(1,2,4-triazol-1-yl)butanamide.
| Compound Name | N-(3-hydroxypropyl)-4-(1,2,4-triazol-1-yl)butanamide |
|---|---|
| PubChem CID | 110899828 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | N-(3-hydroxypropyl)-4-(1,2,4-triazol-1-yl)butanamide |
| SMILES | O=C(CCCn1cncn1)NCCCO |
| InChI | InChI=1S/C9H16N4O2/c14-6-2-4-11-9(15)3-1-5-13-8-10-7-12-13/h7-8,14H,1-6H2,(H,11,15) |
| InChIKey | IOCVUJCCVZWIQE-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|