C11H16N6OS2 — CID 91778266
N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-4-(1,2,4-triazol-1-yl)butanamide (PubChem CID 91778266) has the molecular formula C11H16N6OS2 and a molecular weight of 312.42 g/mol. Its IUPAC name is N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-4-(1,2,4-triazol-1-yl)butanamide.
| Compound Name | N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-4-(1,2,4-triazol-1-yl)butanamide |
|---|---|
| PubChem CID | 91778266 |
| Molecular Formula | C11H16N6OS2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-4-(1,2,4-triazol-1-yl)butanamide |
| SMILES | Cc1nnc(SCCNC(=O)CCCn2cncn2)s1 |
| InChI | InChI=1S/C11H16N6OS2/c1-9-15-16-11(20-9)19-6-4-13-10(18)3-2-5-17-8-12-7-14-17/h7-8H,2-6H2,1H3,(H,13,18) |
| InChIKey | WYXMZTJTXQYBMV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|