C12H17N5OS2 — CID 126433936
(2S)-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-2-pyrazol-1-ylpropanamide (PubChem CID 126433936) has the molecular formula C12H17N5OS2 and a molecular weight of 311.44 g/mol. Its IUPAC name is (2S)-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-2-pyrazol-1-ylpropanamide.
| Compound Name | (2S)-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-2-pyrazol-1-ylpropanamide |
|---|---|
| PubChem CID | 126433936 |
| Molecular Formula | C12H17N5OS2 |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | (2S)-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-2-pyrazol-1-ylpropanamide |
| SMILES | Cc1nnc(SCCCNC(=O)[C@H](C)n2cccn2)s1 |
| InChI | InChI=1S/C12H17N5OS2/c1-9(17-7-3-6-14-17)11(18)13-5-4-8-19-12-16-15-10(2)20-12/h3,6-7,9H,4-5,8H2,1-2H3,(H,13,18)/t9-/m0/s1 |
| InChIKey | POYVBYCURPVVCM-VIFPVBQESA-N |
| XLogP | 1.90 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|