C17H18N6OS2 — CID 74240978
2-anilino-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]pyrimidine-5-carboxamide (PubChem CID 74240978) has the molecular formula C17H18N6OS2 and a molecular weight of 386.51 g/mol. Its IUPAC name is 2-anilino-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]pyrimidine-5-carboxamide.
| Compound Name | 2-anilino-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 74240978 |
| Molecular Formula | C17H18N6OS2 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-anilino-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]pyrimidine-5-carboxamide |
| SMILES | Cc1nnc(SCCCNC(=O)c2cnc(Nc3ccccc3)nc2)s1 |
| InChI | InChI=1S/C17H18N6OS2/c1-12-22-23-17(26-12)25-9-5-8-18-15(24)13-10-19-16(20-11-13)21-14-6-3-2-4-7-14/h2-4,6-7,10-11H,5,8-9H2,1H3,(H,18,24)(H,19,20,21) |
| InChIKey | XGZYJOLWYRYBPP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|