C15H17N3OS3 — CID 77097356
N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-2,3-dihydro-1-benzothiophene-2-carboxamide (PubChem CID 77097356) has the molecular formula C15H17N3OS3 and a molecular weight of 351.52 g/mol. Its IUPAC name is N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-2,3-dihydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-2,3-dihydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 77097356 |
| Molecular Formula | C15H17N3OS3 |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-2,3-dihydro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1nnc(SCCCNC(=O)C2Cc3ccccc3S2)s1 |
| InChI | InChI=1S/C15H17N3OS3/c1-10-17-18-15(21-10)20-8-4-7-16-14(19)13-9-11-5-2-3-6-12(11)22-13/h2-3,5-6,13H,4,7-9H2,1H3,(H,16,19) |
| InChIKey | OYHJIFJGUSRYDO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|