C13H18N2OS — CID 79217188
N-[3-(methylamino)propyl]-2,3-dihydro-1-benzothiophene-2-carboxamide (PubChem CID 79217188) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]-2,3-dihydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[3-(methylamino)propyl]-2,3-dihydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 79217188 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | N-[3-(methylamino)propyl]-2,3-dihydro-1-benzothiophene-2-carboxamide |
| SMILES | CNCCCNC(=O)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C13H18N2OS/c1-14-7-4-8-15-13(16)12-9-10-5-2-3-6-11(10)17-12/h2-3,5-6,12,14H,4,7-9H2,1H3,(H,15,16) |
| InChIKey | GUDHBGPVLSEIRR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|