C9H11N5OS3 — CID 46998399
N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]thiadiazole-4-carboxamide (PubChem CID 46998399) has the molecular formula C9H11N5OS3 and a molecular weight of 301.42 g/mol. Its IUPAC name is N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]thiadiazole-4-carboxamide.
| Compound Name | N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 46998399 |
| Molecular Formula | C9H11N5OS3 |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]thiadiazole-4-carboxamide |
| SMILES | Cc1nnc(SCCCNC(=O)c2csnn2)s1 |
| InChI | InChI=1S/C9H11N5OS3/c1-6-11-13-9(18-6)16-4-2-3-10-8(15)7-5-17-14-12-7/h5H,2-4H2,1H3,(H,10,15) |
| InChIKey | DVTJQLJYKMHMPK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|