C14H19N3O3S2 — CID 46996193
2,2-dimethyl-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-4-oxo-3H-pyran-6-carboxamide (PubChem CID 46996193) has the molecular formula C14H19N3O3S2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 2,2-dimethyl-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-4-oxo-3H-pyran-6-carboxamide.
| Compound Name | 2,2-dimethyl-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-4-oxo-3H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 46996193 |
| Molecular Formula | C14H19N3O3S2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 2,2-dimethyl-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-4-oxo-3H-pyran-6-carboxamide |
| SMILES | Cc1nnc(SCCCNC(=O)C2=CC(=O)CC(C)(C)O2)s1 |
| InChI | InChI=1S/C14H19N3O3S2/c1-9-16-17-13(22-9)21-6-4-5-15-12(19)11-7-10(18)8-14(2,3)20-11/h7H,4-6,8H2,1-3H3,(H,15,19) |
| InChIKey | CZASVUXWABJHTH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|