C14H16N4O3S2 — CID 72843577
1-(1,3-benzodioxol-5-yl)-3-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]urea (PubChem CID 72843577) has the molecular formula C14H16N4O3S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]urea |
|---|---|
| PubChem CID | 72843577 |
| Molecular Formula | C14H16N4O3S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]urea |
| SMILES | Cc1nnc(SCCCNC(=O)Nc2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C14H16N4O3S2/c1-9-17-18-14(23-9)22-6-2-5-15-13(19)16-10-3-4-11-12(7-10)21-8-20-11/h3-4,7H,2,5-6,8H2,1H3,(H2,15,16,19) |
| InChIKey | GZKXLQUBNXXNSC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|