C13H15N3O3S — CID 155519779
1-(1,3-benzodioxol-5-yl)-3-(4-isothiocyanatobutyl)urea (PubChem CID 155519779) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(4-isothiocyanatobutyl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(4-isothiocyanatobutyl)urea |
|---|---|
| PubChem CID | 155519779 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(4-isothiocyanatobutyl)urea |
| SMILES | O=C(NCCCCN=C=S)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H15N3O3S/c17-13(15-6-2-1-5-14-8-20)16-10-3-4-11-12(7-10)19-9-18-11/h3-4,7H,1-2,5-6,9H2,(H2,15,16,17) |
| InChIKey | BMSRLXZGVTZXHY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|