C17H26N4O3 — CID 23609356
1-(1,3-benzodioxol-5-yl)-3-[2-(4-propylpiperazin-1-yl)ethyl]urea (PubChem CID 23609356) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[2-(4-propylpiperazin-1-yl)ethyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[2-(4-propylpiperazin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 23609356 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[2-(4-propylpiperazin-1-yl)ethyl]urea |
| SMILES | CCCN1CCN(CCNC(=O)Nc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C17H26N4O3/c1-2-6-20-8-10-21(11-9-20)7-5-18-17(22)19-14-3-4-15-16(12-14)24-13-23-15/h3-4,12H,2,5-11,13H2,1H3,(H2,18,19,22) |
| InChIKey | ABFBCLZDYSSDKK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |