C19H22N4O3 — CID 121139470
1-(1,3-benzodioxol-5-yl)-3-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]urea (PubChem CID 121139470) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 121139470 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]urea |
| SMILES | O=C(NCCn1nc(C2CC2)cc1C1CC1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H22N4O3/c24-19(21-14-5-6-17-18(9-14)26-11-25-17)20-7-8-23-16(13-3-4-13)10-15(22-23)12-1-2-12/h5-6,9-10,12-13H,1-4,7-8,11H2,(H2,20,21,24) |
| InChIKey | ADPUWWUJIXESND-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |