C12H10N2O3S — CID 110863143
N-(1,3-benzodioxol-5-yl)-2-methyl-1,3-thiazole-5-carboxamide (PubChem CID 110863143) has the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 110863143 |
| Molecular Formula | C12H10N2O3S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncc(C(=O)Nc2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C12H10N2O3S/c1-7-13-5-11(18-7)12(15)14-8-2-3-9-10(4-8)17-6-16-9/h2-5H,6H2,1H3,(H,14,15) |
| InChIKey | UIENEEWVAGRHQQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |