C13H12N2O3S — CID 113424571
2-[4-[(2-methyl-1,3-thiazole-5-carbonyl)amino]phenyl]acetic acid (PubChem CID 113424571) has the molecular formula C13H12N2O3S and a molecular weight of 276.32 g/mol. Its IUPAC name is 2-[4-[(2-methyl-1,3-thiazole-5-carbonyl)amino]phenyl]acetic acid.
| Compound Name | 2-[4-[(2-methyl-1,3-thiazole-5-carbonyl)amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 113424571 |
| Molecular Formula | C13H12N2O3S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 2-[4-[(2-methyl-1,3-thiazole-5-carbonyl)amino]phenyl]acetic acid |
| SMILES | Cc1ncc(C(=O)Nc2ccc(CC(=O)O)cc2)s1 |
| InChI | InChI=1S/C13H12N2O3S/c1-8-14-7-11(19-8)13(18)15-10-4-2-9(3-5-10)6-12(16)17/h2-5,7H,6H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | PEAASMUCNWFNID-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |