C13H15N3OS — CID 110861936
N-[4-(dimethylamino)phenyl]-2-methyl-1,3-thiazole-5-carboxamide (PubChem CID 110861936) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 110861936 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncc(C(=O)Nc2ccc(N(C)C)cc2)s1 |
| InChI | InChI=1S/C13H15N3OS/c1-9-14-8-12(18-9)13(17)15-10-4-6-11(7-5-10)16(2)3/h4-8H,1-3H3,(H,15,17) |
| InChIKey | ARSKRHXKHNHAFX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|