C13H9Br2NO3S — CID 43092929
2-[4-[(4,5-dibromothiophene-2-carbonyl)amino]phenyl]acetic acid (PubChem CID 43092929) has the molecular formula C13H9Br2NO3S and a molecular weight of 419.09 g/mol. Its IUPAC name is 2-[4-[(4,5-dibromothiophene-2-carbonyl)amino]phenyl]acetic acid.
| Compound Name | 2-[4-[(4,5-dibromothiophene-2-carbonyl)amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 43092929 |
| Molecular Formula | C13H9Br2NO3S |
| Molecular Weight | 419.09 g/mol |
| Exact Mass | 416.87 |
| IUPAC Name | 2-[4-[(4,5-dibromothiophene-2-carbonyl)amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(NC(=O)c2cc(Br)c(Br)s2)cc1 |
| InChI | InChI=1S/C13H9Br2NO3S/c14-9-6-10(20-12(9)15)13(19)16-8-3-1-7(2-4-8)5-11(17)18/h1-4,6H,5H2,(H,16,19)(H,17,18) |
| InChIKey | SLDJMKHUEHBXIE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.09 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |