C11H5Br2F2NOS — CID 41248376
4,5-dibromo-N-(3,5-difluorophenyl)thiophene-2-carboxamide (PubChem CID 41248376) has the molecular formula C11H5Br2F2NOS and a molecular weight of 397.04 g/mol. Its IUPAC name is 4,5-dibromo-N-(3,5-difluorophenyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(3,5-difluorophenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 41248376 |
| Molecular Formula | C11H5Br2F2NOS |
| Molecular Weight | 397.04 g/mol |
| Exact Mass | 394.84 |
| IUPAC Name | 4,5-dibromo-N-(3,5-difluorophenyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(F)c1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H5Br2F2NOS/c12-8-4-9(18-10(8)13)11(17)16-7-2-5(14)1-6(15)3-7/h1-4H,(H,16,17) |
| InChIKey | HWLPGCPSOJJXHP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.04 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |