C14H13NO3S — CID 47114542
N-(1,3-benzodioxol-5-yl)-5-ethylthiophene-2-carboxamide (PubChem CID 47114542) has the molecular formula C14H13NO3S and a molecular weight of 275.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-ethylthiophene-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-ethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 47114542 |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-ethylthiophene-2-carboxamide |
| SMILES | CCc1ccc(C(=O)Nc2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C14H13NO3S/c1-2-10-4-6-13(19-10)14(16)15-9-3-5-11-12(7-9)18-8-17-11/h3-7H,2,8H2,1H3,(H,15,16) |
| InChIKey | SVTFPBUYRHEAPF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |