C18H12ClNO3S — CID 26718880
N-(1,3-benzodioxol-5-yl)-5-(4-chlorophenyl)thiophene-2-carboxamide (PubChem CID 26718880) has the molecular formula C18H12ClNO3S and a molecular weight of 357.82 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-(4-chlorophenyl)thiophene-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-(4-chlorophenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 26718880 |
| Molecular Formula | C18H12ClNO3S |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-(4-chlorophenyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccc(-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C18H12ClNO3S/c19-12-3-1-11(2-4-12)16-7-8-17(24-16)18(21)20-13-5-6-14-15(9-13)23-10-22-14/h1-9H,10H2,(H,20,21) |
| InChIKey | DRTJFFAYCWNYRP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |