C20H14ClNO3 — CID 141145423
N-[3-(3-chlorophenyl)phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 141145423) has the molecular formula C20H14ClNO3 and a molecular weight of 351.79 g/mol. Its IUPAC name is N-[3-(3-chlorophenyl)phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-(3-chlorophenyl)phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 141145423 |
| Molecular Formula | C20H14ClNO3 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | N-[3-(3-chlorophenyl)phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1cccc(-c2cccc(Cl)c2)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H14ClNO3/c21-16-5-1-3-13(9-16)14-4-2-6-17(10-14)22-20(23)15-7-8-18-19(11-15)25-12-24-18/h1-11H,12H2,(H,22,23) |
| InChIKey | GZYDOIJWNNCZDO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |