C16H13ClN2O4 — CID 26578694
N-[2-(3-chloroanilino)-2-oxoethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 26578694) has the molecular formula C16H13ClN2O4 and a molecular weight of 332.74 g/mol. Its IUPAC name is N-[2-(3-chloroanilino)-2-oxoethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-(3-chloroanilino)-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 26578694 |
| Molecular Formula | C16H13ClN2O4 |
| Molecular Weight | 332.74 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | N-[2-(3-chloroanilino)-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H13ClN2O4/c17-11-2-1-3-12(7-11)19-15(20)8-18-16(21)10-4-5-13-14(6-10)23-9-22-13/h1-7H,8-9H2,(H,18,21)(H,19,20) |
| InChIKey | JPXSZWMMKLRBFB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.74 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |