C17H16N2O4 — CID 647324
N-[3-(propanoylamino)phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 647324) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is N-[3-(propanoylamino)phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-(propanoylamino)phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 647324 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-[3-(propanoylamino)phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CCC(=O)Nc1cccc(NC(=O)c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C17H16N2O4/c1-2-16(20)18-12-4-3-5-13(9-12)19-17(21)11-6-7-14-15(8-11)23-10-22-14/h3-9H,2,10H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | KAVWXKRMUHQABG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |