C20H14ClN3O4 — CID 109092846
4-N-(1,3-benzodioxol-5-yl)-2-N-(3-chlorophenyl)pyridine-2,4-dicarboxamide (PubChem CID 109092846) has the molecular formula C20H14ClN3O4 and a molecular weight of 395.80 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-yl)-2-N-(3-chlorophenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(1,3-benzodioxol-5-yl)-2-N-(3-chlorophenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109092846 |
| Molecular Formula | C20H14ClN3O4 |
| Molecular Weight | 395.80 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-yl)-2-N-(3-chlorophenyl)pyridine-2,4-dicarboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccnc(C(=O)Nc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C20H14ClN3O4/c21-13-2-1-3-14(9-13)24-20(26)16-8-12(6-7-22-16)19(25)23-15-4-5-17-18(10-15)28-11-27-17/h1-10H,11H2,(H,23,25)(H,24,26) |
| InChIKey | RCEIYCJFNVRMFO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.80 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |