C18H13ClN4O3 — CID 109292906
N-(1,3-benzodioxol-5-yl)-5-(4-chloroanilino)pyrazine-2-carboxamide (PubChem CID 109292906) has the molecular formula C18H13ClN4O3 and a molecular weight of 368.78 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-(4-chloroanilino)pyrazine-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-(4-chloroanilino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109292906 |
| Molecular Formula | C18H13ClN4O3 |
| Molecular Weight | 368.78 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-(4-chloroanilino)pyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1cnc(Nc2ccc(Cl)cc2)cn1 |
| InChI | InChI=1S/C18H13ClN4O3/c19-11-1-3-12(4-2-11)22-17-9-20-14(8-21-17)18(24)23-13-5-6-15-16(7-13)26-10-25-15/h1-9H,10H2,(H,21,22)(H,23,24) |
| InChIKey | DDKQBAPLXBSDGA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.78 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |