C20H18N4O5 — CID 109293894
5-(1,3-benzodioxol-5-ylamino)-N-(2,5-dimethoxyphenyl)pyrazine-2-carboxamide (PubChem CID 109293894) has the molecular formula C20H18N4O5 and a molecular weight of 394.39 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylamino)-N-(2,5-dimethoxyphenyl)pyrazine-2-carboxamide.
| Compound Name | 5-(1,3-benzodioxol-5-ylamino)-N-(2,5-dimethoxyphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109293894 |
| Molecular Formula | C20H18N4O5 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylamino)-N-(2,5-dimethoxyphenyl)pyrazine-2-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2cnc(Nc3ccc4c(c3)OCO4)cn2)c1 |
| InChI | InChI=1S/C20H18N4O5/c1-26-13-4-6-16(27-2)14(8-13)24-20(25)15-9-22-19(10-21-15)23-12-3-5-17-18(7-12)29-11-28-17/h3-10H,11H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | LHBWBUZNTPOWON-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |