C20H18N4O5 — CID 109359207
N-(1,3-benzodioxol-5-yl)-6-(2,5-dimethoxyanilino)pyrimidine-4-carboxamide (PubChem CID 109359207) has the molecular formula C20H18N4O5 and a molecular weight of 394.39 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-(2,5-dimethoxyanilino)pyrimidine-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-(2,5-dimethoxyanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109359207 |
| Molecular Formula | C20H18N4O5 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-(2,5-dimethoxyanilino)pyrimidine-4-carboxamide |
| SMILES | COc1ccc(OC)c(Nc2cc(C(=O)Nc3ccc4c(c3)OCO4)ncn2)c1 |
| InChI | InChI=1S/C20H18N4O5/c1-26-13-4-6-16(27-2)14(8-13)24-19-9-15(21-10-22-19)20(25)23-12-3-5-17-18(7-12)29-11-28-17/h3-10H,11H2,1-2H3,(H,23,25)(H,21,22,24) |
| InChIKey | FTAQCJCXEOELFU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |