C19H16N4O4 — CID 109129169
N-(1,3-benzodioxol-5-yl)-6-(2-methoxyanilino)pyridazine-3-carboxamide (PubChem CID 109129169) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-(2-methoxyanilino)pyridazine-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-(2-methoxyanilino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109129169 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-(2-methoxyanilino)pyridazine-3-carboxamide |
| SMILES | COc1ccccc1Nc1ccc(C(=O)Nc2ccc3c(c2)OCO3)nn1 |
| InChI | InChI=1S/C19H16N4O4/c1-25-15-5-3-2-4-13(15)21-18-9-7-14(22-23-18)19(24)20-12-6-8-16-17(10-12)27-11-26-16/h2-10H,11H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | UISOWQLVQVOGRB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |