C20H20N4O3 — CID 109129147
6-(2-methoxyanilino)-N-(2-methoxy-5-methylphenyl)pyridazine-3-carboxamide (PubChem CID 109129147) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 6-(2-methoxyanilino)-N-(2-methoxy-5-methylphenyl)pyridazine-3-carboxamide.
| Compound Name | 6-(2-methoxyanilino)-N-(2-methoxy-5-methylphenyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109129147 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 6-(2-methoxyanilino)-N-(2-methoxy-5-methylphenyl)pyridazine-3-carboxamide |
| SMILES | COc1ccc(C)cc1NC(=O)c1ccc(Nc2ccccc2OC)nn1 |
| InChI | InChI=1S/C20H20N4O3/c1-13-8-10-18(27-3)16(12-13)22-20(25)15-9-11-19(24-23-15)21-14-6-4-5-7-17(14)26-2/h4-12H,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | VYLJVOFBLXNALC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |