C20H20N4O4 — CID 109129150
N-(2,5-dimethoxyphenyl)-6-(2-methoxyanilino)pyridazine-3-carboxamide (PubChem CID 109129150) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-6-(2-methoxyanilino)pyridazine-3-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-6-(2-methoxyanilino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109129150 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-6-(2-methoxyanilino)pyridazine-3-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2ccc(Nc3ccccc3OC)nn2)c1 |
| InChI | InChI=1S/C20H20N4O4/c1-26-13-8-10-18(28-3)16(12-13)22-20(25)15-9-11-19(24-23-15)21-14-6-4-5-7-17(14)27-2/h4-12H,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | WXXIRBFEQUDRBO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |