C18H11F3N4O3 — CID 109130169
N-(1,3-benzodioxol-5-yl)-6-(2,3,4-trifluoroanilino)pyridazine-3-carboxamide (PubChem CID 109130169) has the molecular formula C18H11F3N4O3 and a molecular weight of 388.31 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-(2,3,4-trifluoroanilino)pyridazine-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-(2,3,4-trifluoroanilino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109130169 |
| Molecular Formula | C18H11F3N4O3 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-(2,3,4-trifluoroanilino)pyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccc(Nc2ccc(F)c(F)c2F)nn1 |
| InChI | InChI=1S/C18H11F3N4O3/c19-10-2-3-11(17(21)16(10)20)23-15-6-4-12(24-25-15)18(26)22-9-1-5-13-14(7-9)28-8-27-13/h1-7H,8H2,(H,22,26)(H,23,25) |
| InChIKey | SYIABWGIRCLMHW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|