C18H13F3N4O — CID 109127073
6-(4-methylanilino)-N-(2,3,4-trifluorophenyl)pyridazine-3-carboxamide (PubChem CID 109127073) has the molecular formula C18H13F3N4O and a molecular weight of 358.32 g/mol. Its IUPAC name is 6-(4-methylanilino)-N-(2,3,4-trifluorophenyl)pyridazine-3-carboxamide.
| Compound Name | 6-(4-methylanilino)-N-(2,3,4-trifluorophenyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109127073 |
| Molecular Formula | C18H13F3N4O |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 6-(4-methylanilino)-N-(2,3,4-trifluorophenyl)pyridazine-3-carboxamide |
| SMILES | Cc1ccc(Nc2ccc(C(=O)Nc3ccc(F)c(F)c3F)nn2)cc1 |
| InChI | InChI=1S/C18H13F3N4O/c1-10-2-4-11(5-3-10)22-15-9-8-14(24-25-15)18(26)23-13-7-6-12(19)16(20)17(13)21/h2-9H,1H3,(H,22,25)(H,23,26) |
| InChIKey | UCEMPVFQHZJEQJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|