C17H9F5N4O — CID 109130401
N-(3,4-difluorophenyl)-6-(2,3,4-trifluoroanilino)pyridazine-3-carboxamide (PubChem CID 109130401) has the molecular formula C17H9F5N4O and a molecular weight of 380.28 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-6-(2,3,4-trifluoroanilino)pyridazine-3-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-6-(2,3,4-trifluoroanilino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109130401 |
| Molecular Formula | C17H9F5N4O |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | N-(3,4-difluorophenyl)-6-(2,3,4-trifluoroanilino)pyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1ccc(Nc2ccc(F)c(F)c2F)nn1 |
| InChI | InChI=1S/C17H9F5N4O/c18-9-2-1-8(7-11(9)20)23-17(27)13-5-6-14(26-25-13)24-12-4-3-10(19)15(21)16(12)22/h1-7H,(H,23,27)(H,24,26) |
| InChIKey | STBSNGUCKFJFMG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|