C18H12F4N4O — CID 109119521
6-[(4-fluorophenyl)methylamino]-N-(2,3,4-trifluorophenyl)pyridazine-3-carboxamide (PubChem CID 109119521) has the molecular formula C18H12F4N4O and a molecular weight of 376.31 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methylamino]-N-(2,3,4-trifluorophenyl)pyridazine-3-carboxamide.
| Compound Name | 6-[(4-fluorophenyl)methylamino]-N-(2,3,4-trifluorophenyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109119521 |
| Molecular Formula | C18H12F4N4O |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 6-[(4-fluorophenyl)methylamino]-N-(2,3,4-trifluorophenyl)pyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1ccc(NCc2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C18H12F4N4O/c19-11-3-1-10(2-4-11)9-23-15-8-7-14(25-26-15)18(27)24-13-6-5-12(20)16(21)17(13)22/h1-8H,9H2,(H,23,26)(H,24,27) |
| InChIKey | AWJHDHWYPJOPRA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|