C18H16FN5O — CID 109119412
6-[(4-fluorophenyl)methylamino]-N-(pyridin-4-ylmethyl)pyridazine-3-carboxamide (PubChem CID 109119412) has the molecular formula C18H16FN5O and a molecular weight of 337.36 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methylamino]-N-(pyridin-4-ylmethyl)pyridazine-3-carboxamide.
| Compound Name | 6-[(4-fluorophenyl)methylamino]-N-(pyridin-4-ylmethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109119412 |
| Molecular Formula | C18H16FN5O |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 6-[(4-fluorophenyl)methylamino]-N-(pyridin-4-ylmethyl)pyridazine-3-carboxamide |
| SMILES | O=C(NCc1ccncc1)c1ccc(NCc2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C18H16FN5O/c19-15-3-1-13(2-4-15)11-21-17-6-5-16(23-24-17)18(25)22-12-14-7-9-20-10-8-14/h1-10H,11-12H2,(H,21,24)(H,22,25) |
| InChIKey | ZOFOCYXRQUEJNC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |