C12H9ClFN3O — CID 60858368
6-chloro-N-[(4-fluorophenyl)methyl]pyridazine-3-carboxamide (PubChem CID 60858368) has the molecular formula C12H9ClFN3O and a molecular weight of 265.68 g/mol. Its IUPAC name is 6-chloro-N-[(4-fluorophenyl)methyl]pyridazine-3-carboxamide.
| Compound Name | 6-chloro-N-[(4-fluorophenyl)methyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 60858368 |
| Molecular Formula | C12H9ClFN3O |
| Molecular Weight | 265.68 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 6-chloro-N-[(4-fluorophenyl)methyl]pyridazine-3-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1ccc(Cl)nn1 |
| InChI | InChI=1S/C12H9ClFN3O/c13-11-6-5-10(16-17-11)12(18)15-7-8-1-3-9(14)4-2-8/h1-6H,7H2,(H,15,18) |
| InChIKey | XRNJQKUBOLLZKP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.68 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |