C13H10ClF2N3O — CID 86025945
6-chloro-N-[2-(2,4-difluorophenyl)ethyl]pyridazine-3-carboxamide (PubChem CID 86025945) has the molecular formula C13H10ClF2N3O and a molecular weight of 297.69 g/mol. Its IUPAC name is 6-chloro-N-[2-(2,4-difluorophenyl)ethyl]pyridazine-3-carboxamide.
| Compound Name | 6-chloro-N-[2-(2,4-difluorophenyl)ethyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 86025945 |
| Molecular Formula | C13H10ClF2N3O |
| Molecular Weight | 297.69 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 6-chloro-N-[2-(2,4-difluorophenyl)ethyl]pyridazine-3-carboxamide |
| SMILES | O=C(NCCc1ccc(F)cc1F)c1ccc(Cl)nn1 |
| InChI | InChI=1S/C13H10ClF2N3O/c14-12-4-3-11(18-19-12)13(20)17-6-5-8-1-2-9(15)7-10(8)16/h1-4,7H,5-6H2,(H,17,20) |
| InChIKey | DEZKPZZOAVOSCN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.69 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |