C10H11F2NO2 — CID 115140069
N-[2-(2,4-difluorophenyl)ethyl]-2-hydroxyacetamide (PubChem CID 115140069) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenyl)ethyl]-2-hydroxyacetamide.
| Compound Name | N-[2-(2,4-difluorophenyl)ethyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 115140069 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | N-[2-(2,4-difluorophenyl)ethyl]-2-hydroxyacetamide |
| SMILES | O=C(CO)NCCc1ccc(F)cc1F |
| InChI | InChI=1S/C10H11F2NO2/c11-8-2-1-7(9(12)5-8)3-4-13-10(15)6-14/h1-2,5,14H,3-4,6H2,(H,13,15) |
| InChIKey | DVJFOVQEUSHENN-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |