C13H17F2NO2 — CID 115186704
N-[2-(2,4-difluorophenyl)ethyl]-2-(hydroxymethyl)butanamide (PubChem CID 115186704) has the molecular formula C13H17F2NO2 and a molecular weight of 257.28 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenyl)ethyl]-2-(hydroxymethyl)butanamide.
| Compound Name | N-[2-(2,4-difluorophenyl)ethyl]-2-(hydroxymethyl)butanamide |
|---|---|
| PubChem CID | 115186704 |
| Molecular Formula | C13H17F2NO2 |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-[2-(2,4-difluorophenyl)ethyl]-2-(hydroxymethyl)butanamide |
| SMILES | CCC(CO)C(=O)NCCc1ccc(F)cc1F |
| InChI | InChI=1S/C13H17F2NO2/c1-2-9(8-17)13(18)16-6-5-10-3-4-11(14)7-12(10)15/h3-4,7,9,17H,2,5-6,8H2,1H3,(H,16,18) |
| InChIKey | PIXKQYLNXZNYDV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |