C14H18F3NO — CID 110481347
2-ethyl-N-[2-(2,3,4-trifluorophenyl)ethyl]butanamide (PubChem CID 110481347) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is 2-ethyl-N-[2-(2,3,4-trifluorophenyl)ethyl]butanamide.
| Compound Name | 2-ethyl-N-[2-(2,3,4-trifluorophenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 110481347 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-ethyl-N-[2-(2,3,4-trifluorophenyl)ethyl]butanamide |
| SMILES | CCC(CC)C(=O)NCCc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H18F3NO/c1-3-9(4-2)14(19)18-8-7-10-5-6-11(15)13(17)12(10)16/h5-6,9H,3-4,7-8H2,1-2H3,(H,18,19) |
| InChIKey | IQHFRNLAJPCUOG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|