C11H12ClF3 — CID 64509327
1-(3-chloropentyl)-2,3,4-trifluorobenzene (PubChem CID 64509327) has the molecular formula C11H12ClF3 and a molecular weight of 236.66 g/mol. Its IUPAC name is 1-(3-chloropentyl)-2,3,4-trifluorobenzene.
| Compound Name | 1-(3-chloropentyl)-2,3,4-trifluorobenzene |
|---|---|
| PubChem CID | 64509327 |
| Molecular Formula | C11H12ClF3 |
| Molecular Weight | 236.66 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 1-(3-chloropentyl)-2,3,4-trifluorobenzene |
| SMILES | CCC(Cl)CCc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H12ClF3/c1-2-8(12)5-3-7-4-6-9(13)11(15)10(7)14/h4,6,8H,2-3,5H2,1H3 |
| InChIKey | IYYLGKBYJCYEIJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.66 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|