C9H5ClF3N — CID 82054462
2-chloro-3-(2,3,4-trifluorophenyl)propanenitrile (PubChem CID 82054462) has the molecular formula C9H5ClF3N and a molecular weight of 219.59 g/mol. Its IUPAC name is 2-chloro-3-(2,3,4-trifluorophenyl)propanenitrile.
| Compound Name | 2-chloro-3-(2,3,4-trifluorophenyl)propanenitrile |
|---|---|
| PubChem CID | 82054462 |
| Molecular Formula | C9H5ClF3N |
| Molecular Weight | 219.59 g/mol |
| Exact Mass | 219.01 |
| IUPAC Name | 2-chloro-3-(2,3,4-trifluorophenyl)propanenitrile |
| SMILES | N#CC(Cl)Cc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C9H5ClF3N/c10-6(4-14)3-5-1-2-7(11)9(13)8(5)12/h1-2,6H,3H2 |
| InChIKey | ZBZZJHJPANNAEZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.59 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|