C9H6F3N — CID 117046772
2-(2,3,4-trifluorophenyl)propanenitrile (PubChem CID 117046772) has the molecular formula C9H6F3N and a molecular weight of 185.15 g/mol. Its IUPAC name is 2-(2,3,4-trifluorophenyl)propanenitrile.
| Compound Name | 2-(2,3,4-trifluorophenyl)propanenitrile |
|---|---|
| PubChem CID | 117046772 |
| Molecular Formula | C9H6F3N |
| Molecular Weight | 185.15 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 2-(2,3,4-trifluorophenyl)propanenitrile |
| SMILES | CC(C#N)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C9H6F3N/c1-5(4-13)6-2-3-7(10)9(12)8(6)11/h2-3,5H,1H3 |
| InChIKey | CXNRIPIITNHHIW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.15 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|