C12H16F3N — CID 62965296
N-ethyl-2-methyl-1-(2,3,4-trifluorophenyl)propan-1-amine (PubChem CID 62965296) has the molecular formula C12H16F3N and a molecular weight of 231.26 g/mol. Its IUPAC name is N-ethyl-2-methyl-1-(2,3,4-trifluorophenyl)propan-1-amine.
| Compound Name | N-ethyl-2-methyl-1-(2,3,4-trifluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 62965296 |
| Molecular Formula | C12H16F3N |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | N-ethyl-2-methyl-1-(2,3,4-trifluorophenyl)propan-1-amine |
| SMILES | CCNC(c1ccc(F)c(F)c1F)C(C)C |
| InChI | InChI=1S/C12H16F3N/c1-4-16-12(7(2)3)8-5-6-9(13)11(15)10(8)14/h5-7,12,16H,4H2,1-3H3 |
| InChIKey | WSBXBRGHMRJZKC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|