C14H20F3N — CID 79411869
N-propyl-1-(2,3,4-trifluorophenyl)pentan-1-amine (PubChem CID 79411869) has the molecular formula C14H20F3N and a molecular weight of 259.31 g/mol. Its IUPAC name is N-propyl-1-(2,3,4-trifluorophenyl)pentan-1-amine.
| Compound Name | N-propyl-1-(2,3,4-trifluorophenyl)pentan-1-amine |
|---|---|
| PubChem CID | 79411869 |
| Molecular Formula | C14H20F3N |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | N-propyl-1-(2,3,4-trifluorophenyl)pentan-1-amine |
| SMILES | CCCCC(NCCC)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H20F3N/c1-3-5-6-12(18-9-4-2)10-7-8-11(15)14(17)13(10)16/h7-8,12,18H,3-6,9H2,1-2H3 |
| InChIKey | ALZPWUJEVGRPPD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|