C16H24F3NO — CID 103031413
4-methoxy-4-methyl-N-propyl-1-(2,3,4-trifluorophenyl)pentan-1-amine (PubChem CID 103031413) has the molecular formula C16H24F3NO and a molecular weight of 303.37 g/mol. Its IUPAC name is 4-methoxy-4-methyl-N-propyl-1-(2,3,4-trifluorophenyl)pentan-1-amine.
| Compound Name | 4-methoxy-4-methyl-N-propyl-1-(2,3,4-trifluorophenyl)pentan-1-amine |
|---|---|
| PubChem CID | 103031413 |
| Molecular Formula | C16H24F3NO |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 4-methoxy-4-methyl-N-propyl-1-(2,3,4-trifluorophenyl)pentan-1-amine |
| SMILES | CCCNC(CCC(C)(C)OC)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H24F3NO/c1-5-10-20-13(8-9-16(2,3)21-4)11-6-7-12(17)15(19)14(11)18/h6-7,13,20H,5,8-10H2,1-4H3 |
| InChIKey | MXKQAYAKXOHYTO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|