C17H28FNO — CID 103031710
1-(5-fluoro-2-methylphenyl)-4-methoxy-4-methyl-N-propylpentan-1-amine (PubChem CID 103031710) has the molecular formula C17H28FNO and a molecular weight of 281.41 g/mol. Its IUPAC name is 1-(5-fluoro-2-methylphenyl)-4-methoxy-4-methyl-N-propylpentan-1-amine.
| Compound Name | 1-(5-fluoro-2-methylphenyl)-4-methoxy-4-methyl-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 103031710 |
| Molecular Formula | C17H28FNO |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | 1-(5-fluoro-2-methylphenyl)-4-methoxy-4-methyl-N-propylpentan-1-amine |
| SMILES | CCCNC(CCC(C)(C)OC)c1cc(F)ccc1C |
| InChI | InChI=1S/C17H28FNO/c1-6-11-19-16(9-10-17(3,4)20-5)15-12-14(18)8-7-13(15)2/h7-8,12,16,19H,6,9-11H2,1-5H3 |
| InChIKey | TVWXXNKJAASXSG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |